C22H18ClN3O2S — CID 19577912
4-chloro-N-[(1,3-diphenylpyrazol-4-yl)methyl]benzenesulfonamide (PubChem CID 19577912) has the molecular formula C22H18ClN3O2S and a molecular weight of 423.93 g/mol. Its IUPAC name is 4-chloro-N-[(1,3-diphenylpyrazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(1,3-diphenylpyrazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19577912 |
| Molecular Formula | C22H18ClN3O2S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 4-chloro-N-[(1,3-diphenylpyrazol-4-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cn(-c2ccccc2)nc1-c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClN3O2S/c23-19-11-13-21(14-12-19)29(27,28)24-15-18-16-26(20-9-5-2-6-10-20)25-22(18)17-7-3-1-4-8-17/h1-14,16,24H,15H2 |
| InChIKey | KJMTZECJAADCPL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |