C14H12F3N3 — CID 115693890
2-[(1-methylpyrrol-2-yl)methylamino]-5-(trifluoromethyl)benzonitrile (PubChem CID 115693890) has the molecular formula C14H12F3N3 and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-[(1-methylpyrrol-2-yl)methylamino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[(1-methylpyrrol-2-yl)methylamino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115693890 |
| Molecular Formula | C14H12F3N3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-[(1-methylpyrrol-2-yl)methylamino]-5-(trifluoromethyl)benzonitrile |
| SMILES | Cn1cccc1CNc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C14H12F3N3/c1-20-6-2-3-12(20)9-19-13-5-4-11(14(15,16)17)7-10(13)8-18/h2-7,19H,9H2,1H3 |
| InChIKey | YTHATKLSTJPNMR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |