C12H13F3N2 — CID 43153532
2-(butylamino)-5-(trifluoromethyl)benzonitrile (PubChem CID 43153532) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-(butylamino)-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-(butylamino)-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 43153532 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 2-(butylamino)-5-(trifluoromethyl)benzonitrile |
| SMILES | CCCCNc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C12H13F3N2/c1-2-3-6-17-11-5-4-10(12(13,14)15)7-9(11)8-16/h4-5,7,17H,2-3,6H2,1H3 |
| InChIKey | ZWHIEIZCIGZPGP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|