C11H10F3N3O — CID 43553728
3-[2-cyano-4-(trifluoromethyl)anilino]propanamide (PubChem CID 43553728) has the molecular formula C11H10F3N3O and a molecular weight of 257.21 g/mol. Its IUPAC name is 3-[2-cyano-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | 3-[2-cyano-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 43553728 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-[2-cyano-4-(trifluoromethyl)anilino]propanamide |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1NCCC(N)=O |
| InChI | InChI=1S/C11H10F3N3O/c12-11(13,14)8-1-2-9(7(5-8)6-15)17-4-3-10(16)18/h1-2,5,17H,3-4H2,(H2,16,18) |
| InChIKey | QZIBEYZRTMNWPA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |