C13H15F3N2O2S — CID 115911140
2-(3-ethylsulfonylpropylamino)-5-(trifluoromethyl)benzonitrile (PubChem CID 115911140) has the molecular formula C13H15F3N2O2S and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-(3-ethylsulfonylpropylamino)-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-(3-ethylsulfonylpropylamino)-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115911140 |
| Molecular Formula | C13H15F3N2O2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-(3-ethylsulfonylpropylamino)-5-(trifluoromethyl)benzonitrile |
| SMILES | CCS(=O)(=O)CCCNc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C13H15F3N2O2S/c1-2-21(19,20)7-3-6-18-12-5-4-11(13(14,15)16)8-10(12)9-17/h4-5,8,18H,2-3,6-7H2,1H3 |
| InChIKey | SEGSYOUKOPZACR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|