C12H14F3N3 — CID 63732029
2-(2-aminobutylamino)-5-(trifluoromethyl)benzonitrile (PubChem CID 63732029) has the molecular formula C12H14F3N3 and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-(2-aminobutylamino)-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-(2-aminobutylamino)-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 63732029 |
| Molecular Formula | C12H14F3N3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-(2-aminobutylamino)-5-(trifluoromethyl)benzonitrile |
| SMILES | CCC(N)CNc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C12H14F3N3/c1-2-10(17)7-18-11-4-3-9(12(13,14)15)5-8(11)6-16/h3-5,10,18H,2,7,17H2,1H3 |
| InChIKey | ZEKGUUCAHUOJKU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |