C13H15F3N2S — CID 115899305
2-(1-methylsulfanylbutan-2-ylamino)-5-(trifluoromethyl)benzonitrile (PubChem CID 115899305) has the molecular formula C13H15F3N2S and a molecular weight of 288.34 g/mol. Its IUPAC name is 2-(1-methylsulfanylbutan-2-ylamino)-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-(1-methylsulfanylbutan-2-ylamino)-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115899305 |
| Molecular Formula | C13H15F3N2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-(1-methylsulfanylbutan-2-ylamino)-5-(trifluoromethyl)benzonitrile |
| SMILES | CCC(CSC)Nc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C13H15F3N2S/c1-3-11(8-19-2)18-12-5-4-10(13(14,15)16)6-9(12)7-17/h4-6,11,18H,3,8H2,1-2H3 |
| InChIKey | OFGGSQGAFSYOIV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |