C10H9F3N2O2S — CID 112556193
N-[2-cyano-4-(trifluoromethyl)phenyl]ethanesulfonamide (PubChem CID 112556193) has the molecular formula C10H9F3N2O2S and a molecular weight of 278.26 g/mol. Its IUPAC name is N-[2-cyano-4-(trifluoromethyl)phenyl]ethanesulfonamide.
| Compound Name | N-[2-cyano-4-(trifluoromethyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 112556193 |
| Molecular Formula | C10H9F3N2O2S |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | N-[2-cyano-4-(trifluoromethyl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C10H9F3N2O2S/c1-2-18(16,17)15-9-4-3-8(10(11,12)13)5-7(9)6-14/h3-5,15H,2H2,1H3 |
| InChIKey | JFLUBEJJXVFEDN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |