C9H9F4NO2S — CID 22773510
N-[2-fluoro-5-(trifluoromethyl)phenyl]ethanesulfonamide (PubChem CID 22773510) has the molecular formula C9H9F4NO2S and a molecular weight of 271.24 g/mol. Its IUPAC name is N-[2-fluoro-5-(trifluoromethyl)phenyl]ethanesulfonamide.
| Compound Name | N-[2-fluoro-5-(trifluoromethyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 22773510 |
| Molecular Formula | C9H9F4NO2S |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | N-[2-fluoro-5-(trifluoromethyl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C9H9F4NO2S/c1-2-17(15,16)14-8-5-6(9(11,12)13)3-4-7(8)10/h3-5,14H,2H2,1H3 |
| InChIKey | MWMRCHBRDVXERI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |