C16H14F4N2O3S — CID 155545113
N-[4-(ethylsulfonylamino)-3-fluorophenyl]-3-(trifluoromethyl)benzamide (PubChem CID 155545113) has the molecular formula C16H14F4N2O3S and a molecular weight of 390.36 g/mol. Its IUPAC name is N-[4-(ethylsulfonylamino)-3-fluorophenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(ethylsulfonylamino)-3-fluorophenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 155545113 |
| Molecular Formula | C16H14F4N2O3S |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N-[4-(ethylsulfonylamino)-3-fluorophenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1F |
| InChI | InChI=1S/C16H14F4N2O3S/c1-2-26(24,25)22-14-7-6-12(9-13(14)17)21-15(23)10-4-3-5-11(8-10)16(18,19)20/h3-9,22H,2H2,1H3,(H,21,23) |
| InChIKey | CHDPTYXRYTYOPC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |