C23H19F3N2O4S — CID 46542208
N-[3-methyl-4-[(3-methylsulfonylbenzoyl)amino]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 46542208) has the molecular formula C23H19F3N2O4S and a molecular weight of 476.48 g/mol. Its IUPAC name is N-[3-methyl-4-[(3-methylsulfonylbenzoyl)amino]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-methyl-4-[(3-methylsulfonylbenzoyl)amino]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 46542208 |
| Molecular Formula | C23H19F3N2O4S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | N-[3-methyl-4-[(3-methylsulfonylbenzoyl)amino]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(C(F)(F)F)c2)ccc1NC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H19F3N2O4S/c1-14-11-18(27-21(29)15-5-3-7-17(12-15)23(24,25)26)9-10-20(14)28-22(30)16-6-4-8-19(13-16)33(2,31)32/h3-13H,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | IMWYSCPTHZUQHL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |