C15H9F7N2O3S — CID 155550237
N-[3-fluoro-4-(trifluoromethylsulfonylamino)phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 155550237) has the molecular formula C15H9F7N2O3S and a molecular weight of 430.30 g/mol. Its IUPAC name is N-[3-fluoro-4-(trifluoromethylsulfonylamino)phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-fluoro-4-(trifluoromethylsulfonylamino)phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 155550237 |
| Molecular Formula | C15H9F7N2O3S |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | N-[3-fluoro-4-(trifluoromethylsulfonylamino)phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(NS(=O)(=O)C(F)(F)F)c(F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9F7N2O3S/c16-11-7-10(4-5-12(11)24-28(26,27)15(20,21)22)23-13(25)8-2-1-3-9(6-8)14(17,18)19/h1-7,24H,(H,23,25) |
| InChIKey | UWJZBGVKMZIEMN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |