C15H11F3N2O2 — CID 86646005
N-(3-formamidophenyl)-3-(trifluoromethyl)benzamide (PubChem CID 86646005) has the molecular formula C15H11F3N2O2 and a molecular weight of 308.26 g/mol. Its IUPAC name is N-(3-formamidophenyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(3-formamidophenyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 86646005 |
| Molecular Formula | C15H11F3N2O2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-(3-formamidophenyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=CNc1cccc(NC(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H11F3N2O2/c16-15(17,18)11-4-1-3-10(7-11)14(22)20-13-6-2-5-12(8-13)19-9-21/h1-9H,(H,19,21)(H,20,22) |
| InChIKey | XBRREOFDIHCPDU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|