C19H20F3N3O2 — CID 119775990
N-[3-[[2-methyl-3-(methylamino)propanoyl]amino]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 119775990) has the molecular formula C19H20F3N3O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is N-[3-[[2-methyl-3-(methylamino)propanoyl]amino]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[[2-methyl-3-(methylamino)propanoyl]amino]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 119775990 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[3-[[2-methyl-3-(methylamino)propanoyl]amino]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CNCC(C)C(=O)Nc1cccc(NC(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H20F3N3O2/c1-12(11-23-2)17(26)24-15-7-4-8-16(10-15)25-18(27)13-5-3-6-14(9-13)19(20,21)22/h3-10,12,23H,11H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | IAYAITYVHMWKGG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |