C14H9ClF3NO3S — CID 16788394
3-[[3-(trifluoromethyl)phenyl]carbamoyl]benzenesulfonyl chloride (PubChem CID 16788394) has the molecular formula C14H9ClF3NO3S and a molecular weight of 363.74 g/mol. Its IUPAC name is 3-[[3-(trifluoromethyl)phenyl]carbamoyl]benzenesulfonyl chloride.
| Compound Name | 3-[[3-(trifluoromethyl)phenyl]carbamoyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 16788394 |
| Molecular Formula | C14H9ClF3NO3S |
| Molecular Weight | 363.74 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 3-[[3-(trifluoromethyl)phenyl]carbamoyl]benzenesulfonyl chloride |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1cccc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C14H9ClF3NO3S/c15-23(21,22)12-6-1-3-9(7-12)13(20)19-11-5-2-4-10(8-11)14(16,17)18/h1-8H,(H,19,20) |
| InChIKey | BISIVRQUYRVZGL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.74 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |