C16H13F3N2O4S — CID 154860777
3-acetyl-N-[4-(trifluoromethylsulfonylamino)phenyl]benzamide (PubChem CID 154860777) has the molecular formula C16H13F3N2O4S and a molecular weight of 386.35 g/mol. Its IUPAC name is 3-acetyl-N-[4-(trifluoromethylsulfonylamino)phenyl]benzamide.
| Compound Name | 3-acetyl-N-[4-(trifluoromethylsulfonylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 154860777 |
| Molecular Formula | C16H13F3N2O4S |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 3-acetyl-N-[4-(trifluoromethylsulfonylamino)phenyl]benzamide |
| SMILES | CC(=O)c1cccc(C(=O)Nc2ccc(NS(=O)(=O)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C16H13F3N2O4S/c1-10(22)11-3-2-4-12(9-11)15(23)20-13-5-7-14(8-6-13)21-26(24,25)16(17,18)19/h2-9,21H,1H3,(H,20,23) |
| InChIKey | UNIWDUQLCLDEPN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |