C22H18N2O6S — CID 1355824
4-[[3-[(3-acetylphenyl)sulfamoyl]benzoyl]amino]benzoic acid (PubChem CID 1355824) has the molecular formula C22H18N2O6S and a molecular weight of 438.46 g/mol. Its IUPAC name is 4-[[3-[(3-acetylphenyl)sulfamoyl]benzoyl]amino]benzoic acid.
| Compound Name | 4-[[3-[(3-acetylphenyl)sulfamoyl]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1355824 |
| Molecular Formula | C22H18N2O6S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 4-[[3-[(3-acetylphenyl)sulfamoyl]benzoyl]amino]benzoic acid |
| SMILES | CC(=O)c1cccc(NS(=O)(=O)c2cccc(C(=O)Nc3ccc(C(=O)O)cc3)c2)c1 |
| InChI | InChI=1S/C22H18N2O6S/c1-14(25)16-4-2-6-19(12-16)24-31(29,30)20-7-3-5-17(13-20)21(26)23-18-10-8-15(9-11-18)22(27)28/h2-13,24H,1H3,(H,23,26)(H,27,28) |
| InChIKey | PUBUOTFILXLRAK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |