C42H36N4O12S2 — CID 158643553
4-[[3-[(3-methoxyphenyl)sulfonylamino]benzoyl]amino]benzoic acid (PubChem CID 158643553) has the molecular formula C42H36N4O12S2 and a molecular weight of 852.90 g/mol. Its IUPAC name is 4-[[3-[(3-methoxyphenyl)sulfonylamino]benzoyl]amino]benzoic acid.
| Compound Name | 4-[[3-[(3-methoxyphenyl)sulfonylamino]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 158643553 |
| Molecular Formula | C42H36N4O12S2 |
| Molecular Weight | 852.90 g/mol |
| Exact Mass | 852.18 |
| IUPAC Name | 4-[[3-[(3-methoxyphenyl)sulfonylamino]benzoyl]amino]benzoic acid |
| SMILES | COc1cccc(S(=O)(=O)Nc2cccc(C(=O)Nc3ccc(C(=O)O)cc3)c2)c1.COc1cccc(S(=O)(=O)Nc2cccc(C(=O)Nc3ccc(C(=O)O)cc3)c2)c1 |
| InChI | InChI=1S/2C21H18N2O6S/c2*1-29-18-6-3-7-19(13-18)30(27,28)23-17-5-2-4-15(12-17)20(24)22-16-10-8-14(9-11-16)21(25)26/h2*2-13,23H,1H3,(H,22,24)(H,25,26) |
| InChIKey | IARKRTLODLYAPC-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 243.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.90 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |