C23H22N2O6S — CID 67549756
ethyl 4-[[3-[(3-methoxyphenyl)sulfonylamino]benzoyl]amino]benzoate (PubChem CID 67549756) has the molecular formula C23H22N2O6S and a molecular weight of 454.50 g/mol. Its IUPAC name is ethyl 4-[[3-[(3-methoxyphenyl)sulfonylamino]benzoyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-[(3-methoxyphenyl)sulfonylamino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 67549756 |
| Molecular Formula | C23H22N2O6S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | ethyl 4-[[3-[(3-methoxyphenyl)sulfonylamino]benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cccc(NS(=O)(=O)c3cccc(OC)c3)c2)cc1 |
| InChI | InChI=1S/C23H22N2O6S/c1-3-31-23(27)16-10-12-18(13-11-16)24-22(26)17-6-4-7-19(14-17)25-32(28,29)21-9-5-8-20(15-21)30-2/h4-15,25H,3H2,1-2H3,(H,24,26) |
| InChIKey | XYTXRHIKYUXOOO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |