C20H21F3N2O5S — CID 55970365
tert-butyl N-[2-[(3-methylsulfonylbenzoyl)amino]-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 55970365) has the molecular formula C20H21F3N2O5S and a molecular weight of 458.46 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-methylsulfonylbenzoyl)amino]-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-methylsulfonylbenzoyl)amino]-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 55970365 |
| Molecular Formula | C20H21F3N2O5S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | tert-butyl N-[2-[(3-methylsulfonylbenzoyl)amino]-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(F)(F)F)cc1NC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H21F3N2O5S/c1-19(2,3)30-18(27)25-15-9-8-13(20(21,22)23)11-16(15)24-17(26)12-6-5-7-14(10-12)31(4,28)29/h5-11H,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | KKTUUINYKOZXPQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |