C12H13F3INO2 — CID 121016303
tert-butyl N-[2-iodo-5-(trifluoromethyl)phenyl]carbamate (PubChem CID 121016303) has the molecular formula C12H13F3INO2 and a molecular weight of 387.14 g/mol. Its IUPAC name is tert-butyl N-[2-iodo-5-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-iodo-5-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 121016303 |
| Molecular Formula | C12H13F3INO2 |
| Molecular Weight | 387.14 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | tert-butyl N-[2-iodo-5-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(F)(F)F)ccc1I |
| InChI | InChI=1S/C12H13F3INO2/c1-11(2,3)19-10(18)17-9-6-7(12(13,14)15)4-5-8(9)16/h4-6H,1-3H3,(H,17,18) |
| InChIKey | PVGSKBYUPGYKOR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.14 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|