C18H23F3N2O4 — CID 87046246
tert-butyl N-[2-(oxane-4-carbonylamino)-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 87046246) has the molecular formula C18H23F3N2O4 and a molecular weight of 388.39 g/mol. Its IUPAC name is tert-butyl N-[2-(oxane-4-carbonylamino)-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-(oxane-4-carbonylamino)-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 87046246 |
| Molecular Formula | C18H23F3N2O4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | tert-butyl N-[2-(oxane-4-carbonylamino)-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(F)(F)F)cc1NC(=O)C1CCOCC1 |
| InChI | InChI=1S/C18H23F3N2O4/c1-17(2,3)27-16(25)23-13-5-4-12(18(19,20)21)10-14(13)22-15(24)11-6-8-26-9-7-11/h4-5,10-11H,6-9H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | SXXRBCANXZELCO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |