C12H14ClF3N2O2 — CID 54307366
tert-butyl N-[2-amino-3-chloro-5-(trifluoromethyl)phenyl]carbamate (PubChem CID 54307366) has the molecular formula C12H14ClF3N2O2 and a molecular weight of 310.70 g/mol. Its IUPAC name is tert-butyl N-[2-amino-3-chloro-5-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-3-chloro-5-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 54307366 |
| Molecular Formula | C12H14ClF3N2O2 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | tert-butyl N-[2-amino-3-chloro-5-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(F)(F)F)cc(Cl)c1N |
| InChI | InChI=1S/C12H14ClF3N2O2/c1-11(2,3)20-10(19)18-8-5-6(12(14,15)16)4-7(13)9(8)17/h4-5H,17H2,1-3H3,(H,18,19) |
| InChIKey | SILSCQHMOKLRJW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|