C12H15F3N2O3 — CID 162534713
tert-butyl N-[2-amino-5-hydroxy-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 162534713) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is tert-butyl N-[2-amino-5-hydroxy-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-5-hydroxy-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 162534713 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | tert-butyl N-[2-amino-5-hydroxy-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(O)c(C(F)(F)F)cc1N |
| InChI | InChI=1S/C12H15F3N2O3/c1-11(2,3)20-10(19)17-8-5-9(18)6(4-7(8)16)12(13,14)15/h4-5,18H,16H2,1-3H3,(H,17,19) |
| InChIKey | YUFOBSNNIFIQLU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|