C13H17F3N2O3 — CID 69487918
tert-butyl N-[2-amino-5-(2,2,2-trifluoroethoxy)phenyl]carbamate (PubChem CID 69487918) has the molecular formula C13H17F3N2O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is tert-butyl N-[2-amino-5-(2,2,2-trifluoroethoxy)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-5-(2,2,2-trifluoroethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 69487918 |
| Molecular Formula | C13H17F3N2O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | tert-butyl N-[2-amino-5-(2,2,2-trifluoroethoxy)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(OCC(F)(F)F)ccc1N |
| InChI | InChI=1S/C13H17F3N2O3/c1-12(2,3)21-11(19)18-10-6-8(4-5-9(10)17)20-7-13(14,15)16/h4-6H,7,17H2,1-3H3,(H,18,19) |
| InChIKey | IXVYZOXGLKDGON-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|