C13H15F3N2O5 — CID 69486960
tert-butyl N-[2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]carbamate (PubChem CID 69486960) has the molecular formula C13H15F3N2O5 and a molecular weight of 336.27 g/mol. Its IUPAC name is tert-butyl N-[2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 69486960 |
| Molecular Formula | C13H15F3N2O5 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | tert-butyl N-[2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(OCC(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15F3N2O5/c1-12(2,3)23-11(19)17-9-6-8(22-7-13(14,15)16)4-5-10(9)18(20)21/h4-6H,7H2,1-3H3,(H,17,19) |
| InChIKey | GCNITTRPZHHGGU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|