C17H26N2O8 — CID 156778145
tert-butyl N-[4,5-bis(2-methoxyethoxy)-2-nitrophenyl]carbamate (PubChem CID 156778145) has the molecular formula C17H26N2O8 and a molecular weight of 386.40 g/mol. Its IUPAC name is tert-butyl N-[4,5-bis(2-methoxyethoxy)-2-nitrophenyl]carbamate.
| Compound Name | tert-butyl N-[4,5-bis(2-methoxyethoxy)-2-nitrophenyl]carbamate |
|---|---|
| PubChem CID | 156778145 |
| Molecular Formula | C17H26N2O8 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | tert-butyl N-[4,5-bis(2-methoxyethoxy)-2-nitrophenyl]carbamate |
| SMILES | COCCOc1cc(NC(=O)OC(C)(C)C)c([N+](=O)[O-])cc1OCCOC |
| InChI | InChI=1S/C17H26N2O8/c1-17(2,3)27-16(20)18-12-10-14(25-8-6-23-4)15(26-9-7-24-5)11-13(12)19(21)22/h10-11H,6-9H2,1-5H3,(H,18,20) |
| InChIKey | XPAACMUKMRUQME-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|