C10H12BrN3O4 — CID 155389995
tert-butyl N-(2-bromo-5-nitro-4-pyridinyl)carbamate (PubChem CID 155389995) has the molecular formula C10H12BrN3O4 and a molecular weight of 318.13 g/mol. Its IUPAC name is tert-butyl N-(2-bromo-5-nitro-4-pyridinyl)carbamate.
| Compound Name | tert-butyl N-(2-bromo-5-nitro-4-pyridinyl)carbamate |
|---|---|
| PubChem CID | 155389995 |
| Molecular Formula | C10H12BrN3O4 |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | tert-butyl N-(2-bromo-5-nitro-4-pyridinyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Br)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12BrN3O4/c1-10(2,3)18-9(15)13-6-4-8(11)12-5-7(6)14(16)17/h4-5H,1-3H3,(H,12,13,15) |
| InChIKey | KFWUFGWIJMGEBH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|