C10H13BrN2O3 — CID 155702377
tert-butyl N-(2-bromo-5-hydroxy-4-pyridinyl)carbamate (PubChem CID 155702377) has the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. Its IUPAC name is tert-butyl N-(2-bromo-5-hydroxy-4-pyridinyl)carbamate.
| Compound Name | tert-butyl N-(2-bromo-5-hydroxy-4-pyridinyl)carbamate |
|---|---|
| PubChem CID | 155702377 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | tert-butyl N-(2-bromo-5-hydroxy-4-pyridinyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Br)ncc1O |
| InChI | InChI=1S/C10H13BrN2O3/c1-10(2,3)16-9(15)13-6-4-8(11)12-5-7(6)14/h4-5,14H,1-3H3,(H,12,13,15) |
| InChIKey | DUWUOBBIXUSZQI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|