C9H14BrN3O2 — CID 146155648
tert-butyl N-(5-bromo-1-methylpyrazol-4-yl)carbamate (PubChem CID 146155648) has the molecular formula C9H14BrN3O2 and a molecular weight of 276.13 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-1-methylpyrazol-4-yl)carbamate.
| Compound Name | tert-butyl N-(5-bromo-1-methylpyrazol-4-yl)carbamate |
|---|---|
| PubChem CID | 146155648 |
| Molecular Formula | C9H14BrN3O2 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | tert-butyl N-(5-bromo-1-methylpyrazol-4-yl)carbamate |
| SMILES | Cn1ncc(NC(=O)OC(C)(C)C)c1Br |
| InChI | InChI=1S/C9H14BrN3O2/c1-9(2,3)15-8(14)12-6-5-11-13(4)7(6)10/h5H,1-4H3,(H,12,14) |
| InChIKey | OUJBNTIXYZUIFA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |