C14H19N3O3 — CID 171597790
tert-butyl N-(5-methoxy-1-methylindazol-4-yl)carbamate (PubChem CID 171597790) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is tert-butyl N-(5-methoxy-1-methylindazol-4-yl)carbamate.
| Compound Name | tert-butyl N-(5-methoxy-1-methylindazol-4-yl)carbamate |
|---|---|
| PubChem CID | 171597790 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | tert-butyl N-(5-methoxy-1-methylindazol-4-yl)carbamate |
| SMILES | COc1ccc2c(cnn2C)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19N3O3/c1-14(2,3)20-13(18)16-12-9-8-15-17(4)10(9)6-7-11(12)19-5/h6-8H,1-5H3,(H,16,18) |
| InChIKey | SIFWSYPTIJJTLN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |