C13H18BrNO3 — CID 156869532
tert-butyl N-(6-bromo-3-methoxy-2-methylphenyl)carbamate (PubChem CID 156869532) has the molecular formula C13H18BrNO3 and a molecular weight of 316.20 g/mol. Its IUPAC name is tert-butyl N-(6-bromo-3-methoxy-2-methylphenyl)carbamate.
| Compound Name | tert-butyl N-(6-bromo-3-methoxy-2-methylphenyl)carbamate |
|---|---|
| PubChem CID | 156869532 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | tert-butyl N-(6-bromo-3-methoxy-2-methylphenyl)carbamate |
| SMILES | COc1ccc(Br)c(NC(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C13H18BrNO3/c1-8-10(17-5)7-6-9(14)11(8)15-12(16)18-13(2,3)4/h6-7H,1-5H3,(H,15,16) |
| InChIKey | GQPGFDWHHDMSJL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |