C11H15BrN2O3 — CID 156516754
tert-butyl N-(5-bromo-6-methoxy-2-pyridinyl)carbamate (PubChem CID 156516754) has the molecular formula C11H15BrN2O3 and a molecular weight of 303.16 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-6-methoxy-2-pyridinyl)carbamate.
| Compound Name | tert-butyl N-(5-bromo-6-methoxy-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 156516754 |
| Molecular Formula | C11H15BrN2O3 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | tert-butyl N-(5-bromo-6-methoxy-2-pyridinyl)carbamate |
| SMILES | COc1nc(NC(=O)OC(C)(C)C)ccc1Br |
| InChI | InChI=1S/C11H15BrN2O3/c1-11(2,3)17-10(15)14-8-6-5-7(12)9(13-8)16-4/h5-6H,1-4H3,(H,13,14,15) |
| InChIKey | GYLZPBDEPTVLDA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |