C11H13ClN2O3 — CID 123779338
tert-butyl N-(5-chloro-6-formyl-2-pyridinyl)carbamate (PubChem CID 123779338) has the molecular formula C11H13ClN2O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is tert-butyl N-(5-chloro-6-formyl-2-pyridinyl)carbamate.
| Compound Name | tert-butyl N-(5-chloro-6-formyl-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 123779338 |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | tert-butyl N-(5-chloro-6-formyl-2-pyridinyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cl)c(C=O)n1 |
| InChI | InChI=1S/C11H13ClN2O3/c1-11(2,3)17-10(16)14-9-5-4-7(12)8(6-15)13-9/h4-6H,1-3H3,(H,13,14,16) |
| InChIKey | UBEDHLURPZPCOU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|