C12H13ClN2O4 — CID 134128965
tert-butyl N-(6-chloro-2,4-diformyl-3-pyridinyl)carbamate (PubChem CID 134128965) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is tert-butyl N-(6-chloro-2,4-diformyl-3-pyridinyl)carbamate.
| Compound Name | tert-butyl N-(6-chloro-2,4-diformyl-3-pyridinyl)carbamate |
|---|---|
| PubChem CID | 134128965 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | tert-butyl N-(6-chloro-2,4-diformyl-3-pyridinyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1c(C=O)cc(Cl)nc1C=O |
| InChI | InChI=1S/C12H13ClN2O4/c1-12(2,3)19-11(18)15-10-7(5-16)4-9(13)14-8(10)6-17/h4-6H,1-3H3,(H,15,18) |
| InChIKey | JLDDJHMKYVHCTF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|