C14H18FNO3 — CID 84808075
tert-butyl N-(2-fluoro-4-formyl-3,6-dimethylphenyl)carbamate (PubChem CID 84808075) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is tert-butyl N-(2-fluoro-4-formyl-3,6-dimethylphenyl)carbamate.
| Compound Name | tert-butyl N-(2-fluoro-4-formyl-3,6-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 84808075 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | tert-butyl N-(2-fluoro-4-formyl-3,6-dimethylphenyl)carbamate |
| SMILES | Cc1cc(C=O)c(C)c(F)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H18FNO3/c1-8-6-10(7-17)9(2)11(15)12(8)16-13(18)19-14(3,4)5/h6-7H,1-5H3,(H,16,18) |
| InChIKey | OBRHBALSOZNTJI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|