C12H14FNO5 — CID 84809356
tert-butyl N-(3-fluoro-5-formyl-2,4-dihydroxyphenyl)carbamate (PubChem CID 84809356) has the molecular formula C12H14FNO5 and a molecular weight of 271.24 g/mol. Its IUPAC name is tert-butyl N-(3-fluoro-5-formyl-2,4-dihydroxyphenyl)carbamate.
| Compound Name | tert-butyl N-(3-fluoro-5-formyl-2,4-dihydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 84809356 |
| Molecular Formula | C12H14FNO5 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | tert-butyl N-(3-fluoro-5-formyl-2,4-dihydroxyphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C=O)c(O)c(F)c1O |
| InChI | InChI=1S/C12H14FNO5/c1-12(2,3)19-11(18)14-7-4-6(5-15)9(16)8(13)10(7)17/h4-5,16-17H,1-3H3,(H,14,18) |
| InChIKey | UNZYNBCMVAKIKF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|