C12H13F2NO3 — CID 84805525
tert-butyl N-(2,5-difluoro-4-formylphenyl)carbamate (PubChem CID 84805525) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is tert-butyl N-(2,5-difluoro-4-formylphenyl)carbamate.
| Compound Name | tert-butyl N-(2,5-difluoro-4-formylphenyl)carbamate |
|---|---|
| PubChem CID | 84805525 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | tert-butyl N-(2,5-difluoro-4-formylphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(F)c(C=O)cc1F |
| InChI | InChI=1S/C12H13F2NO3/c1-12(2,3)18-11(17)15-10-5-8(13)7(6-16)4-9(10)14/h4-6H,1-3H3,(H,15,17) |
| InChIKey | LPYOFWKROZCTGF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|