C12H13F4NO3 — CID 177334338
tert-butyl N-[4-(difluoromethoxy)-2,5-difluorophenyl]carbamate (PubChem CID 177334338) has the molecular formula C12H13F4NO3 and a molecular weight of 295.23 g/mol. Its IUPAC name is tert-butyl N-[4-(difluoromethoxy)-2,5-difluorophenyl]carbamate.
| Compound Name | tert-butyl N-[4-(difluoromethoxy)-2,5-difluorophenyl]carbamate |
|---|---|
| PubChem CID | 177334338 |
| Molecular Formula | C12H13F4NO3 |
| Molecular Weight | 295.23 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | tert-butyl N-[4-(difluoromethoxy)-2,5-difluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(F)c(OC(F)F)cc1F |
| InChI | InChI=1S/C12H13F4NO3/c1-12(2,3)20-11(18)17-8-4-7(14)9(5-6(8)13)19-10(15)16/h4-5,10H,1-3H3,(H,17,18) |
| InChIKey | HXLQSDXXTJDQFY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |