C12H13Cl2F2NO3 — CID 65142779
tert-butyl N-[3,5-dichloro-4-(difluoromethoxy)phenyl]carbamate (PubChem CID 65142779) has the molecular formula C12H13Cl2F2NO3 and a molecular weight of 328.14 g/mol. Its IUPAC name is tert-butyl N-[3,5-dichloro-4-(difluoromethoxy)phenyl]carbamate.
| Compound Name | tert-butyl N-[3,5-dichloro-4-(difluoromethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 65142779 |
| Molecular Formula | C12H13Cl2F2NO3 |
| Molecular Weight | 328.14 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | tert-butyl N-[3,5-dichloro-4-(difluoromethoxy)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Cl)c(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2F2NO3/c1-12(2,3)20-11(18)17-6-4-7(13)9(8(14)5-6)19-10(15)16/h4-5,10H,1-3H3,(H,17,18) |
| InChIKey | VVDJRXJQIUNAKI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.14 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |