C11H14F2N2O3 — CID 175169131
tert-butyl N-[2-(difluoromethoxy)-4-pyridinyl]carbamate (PubChem CID 175169131) has the molecular formula C11H14F2N2O3 and a molecular weight of 260.24 g/mol. Its IUPAC name is tert-butyl N-[2-(difluoromethoxy)-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-(difluoromethoxy)-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 175169131 |
| Molecular Formula | C11H14F2N2O3 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | tert-butyl N-[2-(difluoromethoxy)-4-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccnc(OC(F)F)c1 |
| InChI | InChI=1S/C11H14F2N2O3/c1-11(2,3)18-10(16)15-7-4-5-14-8(6-7)17-9(12)13/h4-6,9H,1-3H3,(H,14,15,16) |
| InChIKey | KSRLUEJQKHVWES-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |