C12H16F2N2O3 — CID 59461467
tert-butyl N-[[2-(difluoromethoxy)-4-pyridinyl]methyl]carbamate (PubChem CID 59461467) has the molecular formula C12H16F2N2O3 and a molecular weight of 274.27 g/mol. Its IUPAC name is tert-butyl N-[[2-(difluoromethoxy)-4-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(difluoromethoxy)-4-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 59461467 |
| Molecular Formula | C12H16F2N2O3 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | tert-butyl N-[[2-(difluoromethoxy)-4-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccnc(OC(F)F)c1 |
| InChI | InChI=1S/C12H16F2N2O3/c1-12(2,3)19-11(17)16-7-8-4-5-15-9(6-8)18-10(13)14/h4-6,10H,7H2,1-3H3,(H,16,17) |
| InChIKey | WOUHULLWTYXMIC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |