C23H31ClF6N4O4 — CID 157363354
tert-butyl N-[[2-(3,3,3-trifluoropropoxy)-4-pyridinyl]methyl]carbamate;[2-(3,3,3-trifluoropropoxy)-4-pyridinyl]methanamine;hydrochloride (PubChem CID 157363354) has the molecular formula C23H31ClF6N4O4 and a molecular weight of 576.97 g/mol. Its IUPAC name is tert-butyl N-[[2-(3,3,3-trifluoropropoxy)-4-pyridinyl]methyl]carbamate;[2-(3,3,3-trifluoropropoxy)-4-pyridinyl]methanamine;hydrochloride.
| Compound Name | tert-butyl N-[[2-(3,3,3-trifluoropropoxy)-4-pyridinyl]methyl]carbamate;[2-(3,3,3-trifluoropropoxy)-4-pyridinyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 157363354 |
| Molecular Formula | C23H31ClF6N4O4 |
| Molecular Weight | 576.97 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | tert-butyl N-[[2-(3,3,3-trifluoropropoxy)-4-pyridinyl]methyl]carbamate;[2-(3,3,3-trifluoropropoxy)-4-pyridinyl]methanamine;hydrochloride |
| SMILES | CC(C)(C)OC(=O)NCc1ccnc(OCCC(F)(F)F)c1.Cl.NCc1ccnc(OCCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3N2O3.C9H11F3N2O.ClH/c1-13(2,3)22-12(20)19-9-10-4-6-18-11(8-10)21-7-5-14(15,16)17;10-9(11,12)2-4-15-8-5-7(6-13)1-3-14-8;/h4,6,8H,5,7,9H2,1-3H3,(H,19,20);1,3,5H,2,4,6,13H2;1H |
| InChIKey | BIWWWSNQRJXKCT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.97 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |