C16H18Cl2F3N3O2 — CID 120641796
5-amino-2-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]benzamide;dihydrochloride (PubChem CID 120641796) has the molecular formula C16H18Cl2F3N3O2 and a molecular weight of 412.24 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]benzamide;dihydrochloride.
| Compound Name | 5-amino-2-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 120641796 |
| Molecular Formula | C16H18Cl2F3N3O2 |
| Molecular Weight | 412.24 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 5-amino-2-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]benzamide;dihydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)NCc1ccnc(OCC(F)(F)F)c1.Cl.Cl |
| InChI | InChI=1S/C16H16F3N3O2.2ClH/c1-10-2-3-12(20)7-13(10)15(23)22-8-11-4-5-21-14(6-11)24-9-16(17,18)19;;/h2-7H,8-9,20H2,1H3,(H,22,23);2*1H |
| InChIKey | CFJNQSMVIDAEMH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.24 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|