C14H20F3N3O2S — CID 155043342
1-(tert-butylsulfanylmethyl)-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]urea (PubChem CID 155043342) has the molecular formula C14H20F3N3O2S and a molecular weight of 351.39 g/mol. Its IUPAC name is 1-(tert-butylsulfanylmethyl)-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]urea.
| Compound Name | 1-(tert-butylsulfanylmethyl)-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 155043342 |
| Molecular Formula | C14H20F3N3O2S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1-(tert-butylsulfanylmethyl)-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]urea |
| SMILES | CC(C)(C)SCNC(=O)NCc1ccnc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F3N3O2S/c1-13(2,3)23-9-20-12(21)19-7-10-4-5-18-11(6-10)22-8-14(15,16)17/h4-6H,7-9H2,1-3H3,(H2,19,20,21) |
| InChIKey | HVRNXVRVSFNPLT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|