C17H16F3N3O3S — CID 47044343
N'-(4-methylsulfanylphenyl)-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]oxamide (PubChem CID 47044343) has the molecular formula C17H16F3N3O3S and a molecular weight of 399.39 g/mol. Its IUPAC name is N'-(4-methylsulfanylphenyl)-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]oxamide.
| Compound Name | N'-(4-methylsulfanylphenyl)-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]oxamide |
|---|---|
| PubChem CID | 47044343 |
| Molecular Formula | C17H16F3N3O3S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N'-(4-methylsulfanylphenyl)-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]oxamide |
| SMILES | CSc1ccc(NC(=O)C(=O)NCc2ccnc(OCC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H16F3N3O3S/c1-27-13-4-2-12(3-5-13)23-16(25)15(24)22-9-11-6-7-21-14(8-11)26-10-17(18,19)20/h2-8H,9-10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | GYQSJJJVRSBHBF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|