C8H11FN2O — CID 171787152
[2-(2-fluoroethoxy)-4-pyridinyl]methanamine (PubChem CID 171787152) has the molecular formula C8H11FN2O and a molecular weight of 170.19 g/mol. Its IUPAC name is [2-(2-fluoroethoxy)-4-pyridinyl]methanamine.
| Compound Name | [2-(2-fluoroethoxy)-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 171787152 |
| Molecular Formula | C8H11FN2O |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | [2-(2-fluoroethoxy)-4-pyridinyl]methanamine |
| SMILES | NCc1ccnc(OCCF)c1 |
| InChI | InChI=1S/C8H11FN2O/c9-2-4-12-8-5-7(6-10)1-3-11-8/h1,3,5H,2,4,6,10H2 |
| InChIKey | BUXGSNLRNRQNJY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |