C11H16N2O — CID 114470522
[2-(3-methylbut-3-enoxy)-4-pyridinyl]methanamine (PubChem CID 114470522) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is [2-(3-methylbut-3-enoxy)-4-pyridinyl]methanamine.
| Compound Name | [2-(3-methylbut-3-enoxy)-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 114470522 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | [2-(3-methylbut-3-enoxy)-4-pyridinyl]methanamine |
| SMILES | C=C(C)CCOc1cc(CN)ccn1 |
| InChI | InChI=1S/C11H16N2O/c1-9(2)4-6-14-11-7-10(8-12)3-5-13-11/h3,5,7H,1,4,6,8,12H2,2H3 |
| InChIKey | BGLZOGYQPKSMPW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|