C15H14F3N3O2 — CID 168892356
1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-[3-(fluoromethyl)phenyl]urea (PubChem CID 168892356) has the molecular formula C15H14F3N3O2 and a molecular weight of 325.29 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-[3-(fluoromethyl)phenyl]urea.
| Compound Name | 1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-[3-(fluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 168892356 |
| Molecular Formula | C15H14F3N3O2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-[3-(fluoromethyl)phenyl]urea |
| SMILES | O=C(NCc1ccnc(OC(F)F)c1)Nc1cccc(CF)c1 |
| InChI | InChI=1S/C15H14F3N3O2/c16-8-10-2-1-3-12(6-10)21-15(22)20-9-11-4-5-19-13(7-11)23-14(17)18/h1-7,14H,8-9H2,(H2,20,21,22) |
| InChIKey | VQNVIENXARHARP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |