C16H21F2N3O2 — CID 168891882
1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-spiro[3.4]octan-7-ylurea (PubChem CID 168891882) has the molecular formula C16H21F2N3O2 and a molecular weight of 325.36 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-spiro[3.4]octan-7-ylurea.
| Compound Name | 1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-spiro[3.4]octan-7-ylurea |
|---|---|
| PubChem CID | 168891882 |
| Molecular Formula | C16H21F2N3O2 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-spiro[3.4]octan-7-ylurea |
| SMILES | O=C(NCc1ccnc(OC(F)F)c1)NC1CCC2(CCC2)C1 |
| InChI | InChI=1S/C16H21F2N3O2/c17-14(18)23-13-8-11(3-7-19-13)10-20-15(22)21-12-2-6-16(9-12)4-1-5-16/h3,7-8,12,14H,1-2,4-6,9-10H2,(H2,20,21,22) |
| InChIKey | LYJVENZWVFSIDM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |